PRODUCT Properties
| Melting point: | 237-240 °C |
| alpha | D -473° (c = 0.084 in chloroform) |
| Boiling point: | 387.74°C (rough estimate) |
| Density | 1.3099 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| solubility | DMF: Soluble; DMSO: Soluble; Ethanol: Soluble; Methanol: Soluble |
| form | White to yellow powder. Blue-green fluorescence. |
| color | White to off-white |
| Water Solubility | 15mg/L(temperature not stated) |
| BRN | 1692017 |
| InChI | InChI=1S/C17H14O7/c1-20-9-6-10-12(8-3-5-22-17(8)23-10)14-11(9)7-2-4-21-15(18)13(7)16(19)24-14/h6,8,17H,2-5H2,1H3/t8-,17+/m0/s1 |
| InChIKey | WPCVRWVBBXIRMA-WNWIJWBNSA-N |
| SMILES | C1(=O)OC2C3[C@]4([H])CCO[C@]4([H])OC=3C=C(OC)C=2C2CCOC(=O)C1=2 |
| LogP | 0.443 (est) |
| EPA Substance Registry System | Aflatoxin G2 (7241-98-7) |
Description and Uses
Aflatoxin G2 is the minor analogue of the green fluorescent family of bisfuranocoumarin mycotoxins produced by Aspergillus flavus and related species. Alfatoxins are one of the most potent mycotoxins known but are in fact "pre-toxins", requiring metabolic activation to the toxic principle. Aflatoxins are found widely in nature in trace amounts, particularly in grains and nuts. The toxicity of these metabolites was first recognised in the 1950s and their structures elucidated in 1963. Aflatoxins have been extensively reviewed.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H319-H340-H350-H372-H412 |
| Precautionary statements | P210-P273-P301+P310-P303+P361+P353-P305+P351+P338-P331 |
| Hazard Codes | T+,T,Xn,F |
| Risk Statements | 45-26/27/28-36-20/21/22-11-39/23/24/25-23/24/25-65-48/23/24/25-36/38-46 |
| Safety Statements | 53-28-36/37-45-36-26-16-7-62 |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | LV1700000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 30029090 |
| Hazardous Substances Data | 7241-98-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in day old duckling: 172.5 mg/50 gm body wt (Carnaghan) |









