BD0375932
4-Formyl-3-hydroxybenzoic acid , 98% , 619-12-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB155.20 | In Stock |
|
| 250mg | RMB276.80 | In Stock |
|
| 1g | RMB884.80 | In Stock |
|
| 5g | RMB3096.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 235-240 °C (lit.) |
| Boiling point: | 214.32°C (rough estimate) |
| Density | 1.2208 (rough estimate) |
| refractive index | 1.4611 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | 3.66±0.10(Predicted) |
| Appearance | White to light brown Solid |
| InChI | InChI=1S/C8H6O4/c9-4-6-2-1-5(8(11)12)3-7(6)10/h1-4,10H,(H,11,12) |
| InChIKey | FDDHFCWYCKQKGY-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C=O)C(O)=C1 |
Description and Uses
4-Formyl-3-hydroxybenzoic acid can be used as a reactant to prepare:
- A pH-sensitive fluorescent probe 4,4′-(hydrazine-1,2-diylidene bis(methanylylidene)) bis(3-hydroxybenzoic acid (HDBB) by one-step condensation reaction with hydrazine.
- 2-Oxo-2H-1-benzopyran-3,7-dicarboxylic acid by condensation reaction with diethyl malonate.
- Schiff base ligands for the preparation of stable and functional Schiff base metal complexes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/38-43 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| HS Code | 2918999090 |
