BD0418145
1-Bromo-8-chloronaphthalene , 95% , 20816-79-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB37.60 | In Stock |
|
| 5g | RMB129.60 | In Stock |
|
| 25g | RMB572.00 | In Stock |
|
| 100g | RMB2181.60 | In Stock |
|
| 500g | RMB7132.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-88 °C |
| Boiling point: | 150-160 °C(Press: 5-6 Torr) |
| Density | 1.592±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| InChI | InChI=1S/C10H6BrCl/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H |
| InChIKey | JHZQEADUKRNQBX-UHFFFAOYSA-N |
| SMILES | C1(Br)=C2C(C=CC=C2Cl)=CC=C1 |
Description and Uses
1-Bromo-8-chloronaphthalene is a useful reagent in the preparation of peri-substituted naphthalene series.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H335-H332-H319-H315-H312 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P280-P302+P352-P312-P322-P363-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P261-P271-P304+P340-P312 |