BD0476545
O-MethylheptaethyleneGlycol , 95% , 4437-01-8
Synonym(s):
Methoxyheptaethylene glycol;Monomethoxy-PEG (n=7)
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB41.60 | In Stock |
|
| 250mg | RMB77.60 | In Stock |
|
| 1g | RMB208.80 | In Stock |
|
| 5g | RMB685.60 | In Stock |
|
| 25g | RMB2272.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 150 °C(Press: 0.005 Torr) |
| Density | 1.09 |
| refractive index | 1.4540-1.4580 |
| storage temp. | -20°C |
| form | clear liquid |
| pka | 14.36±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C15H32O8/c1-17-4-5-19-8-9-21-12-13-23-15-14-22-11-10-20-7-6-18-3-2-16/h16H,2-15H2,1H3 |
| InChIKey | AGWKUHGLWHMYTG-UHFFFAOYSA-N |
| SMILES | C(O)COCCOCCOCCOCCOCCOCCOC |
| CAS DataBase Reference | 4437-01-8(CAS DataBase Reference) |
Description and Uses
m-PEG7-alcohol is a PEG linker containing a hydroxyl group. The hydroxyl group enables further derivatization or replacement with other reactive functional groups. The hydrophilic PEG spacer increases solubility in aqueous media.
Applications may include: bioconjugation, drug delivery, PEG hydrogel, crosslinker, and surface functionalization
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 29094990 |
