BD0744453
2-Chloroacrylicacid , 98%+(stabilizedwith0.3-0.5%BHT) , 598-79-8
CAS NO.：598-79-8
Empirical Formula: C3H3ClO2
Molecular Weight: 106.51
MDL number: MFCD00014336
EINECS: 209-953-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB88.00 | In Stock |
|
| 5g | RMB308.80 | In Stock |
|
| 25g | RMB1264.80 | In Stock |
|
| 100g | RMB4384.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65°C |
| Boiling point: | 118.27°C (rough estimate) |
| Density | 1.2288 (rough estimate) |
| refractive index | 1.4100 (estimate) |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | 2.41±0.11(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in water. |
| BRN | 1098503 |
| InChI | InChI=1S/C3H3ClO2/c1-2(4)3(5)6/h1H2,(H,5,6) |
| InChIKey | SZTBMYHIYNGYIA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(Cl)=C |
| CAS DataBase Reference | 598-79-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Alpha-chloroacrylic acid(598-79-8) |
| EPA Substance Registry System | 2-Chloroacrylic acid (598-79-8) |
Description and Uses
2-Chloroacrylic acid is used as a halochemicals, organic synthesis.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3261 |
| RTECS | AS5952000 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
