BD0859532
(S)-2-(4-Fluorophenyl)pyrrolidine , 98% , 298690-90-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB254.40 | In Stock |
|
| 250mg | RMB426.40 | In Stock |
|
| 1g | RMB1162.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 235.5±33.0 °C(Predicted) |
| Density | 1.078±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 9.76±0.10(Predicted) |
| Appearance | Light yellow to brown Liquid |
| InChI | InChI=1S/C10H12FN/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h3-6,10,12H,1-2,7H2/t10-/m0/s1 |
| InChIKey | ZDCXMSDSTZZWAX-JTQLQIEISA-N |
| SMILES | N1CCC[C@H]1C1=CC=C(F)C=C1 |
| CAS DataBase Reference | 298690-90-1(CAS DataBase Reference) |
Description and Uses
(S)-2-(4-Fluorophenyl)pyrrolidine is a pyrrole compound and can be used in the synthesis of organic compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933998090 |
