BD0884832
Ethyl 1-Cyano-1-cyclopropanecarboxylate , 97% , 1558-81-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB79.20 | In Stock |
|
| 10g | RMB153.60 | In Stock |
|
| 25g | RMB309.60 | In Stock |
|
| 100g | RMB1212.80 | In Stock |
|
| 500g | RMB4881.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 217 °C (lit.) |
| Density | 1.077 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 211 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | colorless |
| InChI | InChI=1S/C7H9NO2/c1-2-10-6(9)7(5-8)3-4-7/h2-4H2,1H3 |
| InChIKey | FDZLCIITHLSEQK-UHFFFAOYSA-N |
| SMILES | C1(C#N)(C(OCC)=O)CC1 |
| CAS DataBase Reference | 1558-81-2(CAS DataBase Reference) |
Description and Uses
Ethyl 1-cyano-1-cyclopropanecarboxylate may be used as a monomer in the preparation of poly(ethyl trimethylene-1-cyano-1-carboxylate)s.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405-P501A |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 2926907090 |
