BD1149548
5-Acetyl-1H-pyrazole-3-carboxylicacid , 97% , 1297537-45-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB62.40 | In Stock |
|
| 5g | RMB218.40 | In Stock |
|
| 25g | RMB762.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 257-269 °C (decomp)(Solv: ethanol (64-17-5); benzene (71-43-2)) |
| Boiling point: | 479.2±30.0 °C(Predicted) |
| Density | 1.467±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.60±0.10(Predicted) |
| InChI | InChI=1S/C6H6N2O3/c1-3(9)4-2-5(6(10)11)8-7-4/h2H,1H3,(H,7,8)(H,10,11) |
| InChIKey | HFBWRCZRDIVAMQ-UHFFFAOYSA-N |
| SMILES | N1C(C(C)=O)=CC(C(O)=O)=N1 |
Description and Uses
5-acetyl-1H-pyrazole-3-carboxylic acid can be used in the industrialization of substances such as polyurethanes. Impurities in this chemical are removed through filtration before it is used for synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |