BD1189432
5-Amino-2-bromopyrimidine , 95% , 56621-91-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB81.60 | In Stock |
|
| 250mg | RMB141.60 | In Stock |
|
| 1g | RMB385.60 | In Stock |
|
| 5g | RMB1348.80 | In Stock |
|
| 25g | RMB4720.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-183 °C(Solv: benzene (71-43-2)) |
| Boiling point: | 364.1±34.0 °C(Predicted) |
| Density | 1.844±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | solid |
| pka | -0.15±0.10(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C4H4BrN3/c5-4-7-1-3(6)2-8-4/h1-2H,6H2 |
| InChIKey | BTXWPEMYVHUOPW-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(N)C=N1 |
Description and Uses
5-Amino-2-bromopyrimidine is a reagent used in the synthesis in a bioavailable PPARa antagonist used in the treatment of metabolic syndrome.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933599590 |
