BD1345232
Hoffer's chlorosugar , 90% , 4330-21-6
CAS NO.:4330-21-6
Empirical Formula: C21H21ClO5
Molecular Weight: 388.84
MDL number: MFCD01630916
EINECS: 224-367-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1g | RMB42.40 | In Stock |
|
| 5g | RMB162.40 | In Stock |
|
| 10g | RMB304.80 | In Stock |
|
| 25g | RMB624.80 | In Stock |
|
| 100g | RMB2304.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C |
| Boiling point: | 518.4±50.0 °C(Predicted) |
| Density | 1.28 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Acetone (Slightly), Chloroform (Slightly), DMSO (Slightly, Sonicated), Methanol |
| form | Solid |
| color | Off-White to Light Grey |
| Stability: | Moisture Sensitive |
| InChI | InChI=1/C21H21ClO5/c1-13-3-7-15(8-4-13)20(23)25-12-18-17(11-19(22)26-18)27-21(24)16-9-5-14(2)6-10-16/h3-10,17-19H,11-12H2,1-2H3/t17-,18+,19+/s3 |
| InChIKey | XJHDINDXQMZBKW-XUVXKRRUSA-N |
| SMILES | [C@@H]1(Cl)O[C@H](COC(=O)C2=CC=C(C)C=C2)[C@@H](OC(=O)C2=CC=C(C)C=C2)C1 |&1:0,3,15,r| |
Description and Uses
Hoffer''s Chlorosugar is a synthetic precursor for ribose glycosides and ribonucleosides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29321900 |





