BD1504032
5-Bromo-2-(bromomethyl)-1,3-difluorobenzene , 95+% , 162744-60-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB116.80 | In Stock |
|
| 250mg | RMB173.60 | In Stock |
|
| 1g | RMB432.80 | In Stock |
|
| 5g | RMB1524.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 244℃ |
| Density | 1.991 |
| Flash point: | 101℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | fused / liquid solid |
| color | Clear, almost colourless to pale lemon |
| Sensitive | Lachrymatory |
| InChI | InChI=1S/C7H4Br2F2/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2 |
| InChIKey | VSKMLLGUWKLTQV-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(Br)=CC(F)=C1CBr |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | C |
| RIDADR | UN3265 |
| Hazard Note | Corrosive/Lachrymator |
| HazardClass | 8 |
| HS Code | 2916399090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
