BD2689248
tert-Butyl((3,4-dihydro-2H-pyran-6-yl)oxy)dimethylsilane , 97+% , 130650-09-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1560.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 125-131 °C/28 mmHg (lit.) |
| Density | 0.935 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 177 °F |
| storage temp. | 2-8°C |
| Specific Gravity | 0.935 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | 1S/C11H22O2Si/c1-11(2,3)14(4,5)13-10-8-6-7-9-12-10/h8H,6-7,9H2,1-5H3 |
| InChIKey | RBKFRODDAPGVLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CCCCO1 |
Description and Uses
6-(tert-Butyldimethylsilyloxy)-3,4-dihydro-2H-pyran, a heterocyclic building block, is a pyran derivative. Various physical properties of 6-(tert-butyldimethylsilyloxy)-3,4-dihydro-2H-pyran have been reported.
Safety
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |






