BD3101045
N-Cyano-4-methyl-N-phenylbenzenesulfonamide , 95% , 55305-43-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB70.40 | In Stock |
|
| 250mg | RMB93.60 | In Stock |
|
| 1g | RMB297.60 | In Stock |
|
| 5g | RMB1467.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87 °C |
| Boiling point: | 418.4±38.0 °C(Predicted) |
| Density | 1.317±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | -8.96±0.50(Predicted) |
| color | White |
| InChI | InChI=1S/C14H12N2O2S/c1-12-7-9-14(10-8-12)19(17,18)16(11-15)13-5-3-2-4-6-13/h2-10H,1H3 |
| InChIKey | CIIFNSIDKZSDBR-UHFFFAOYSA-N |
| SMILES | C1(S(N(C#N)C2=CC=CC=C2)(=O)=O)=CC=C(C)C=C1 |
Description and Uses
N-Cyano-N-phenyl-p-toluenesulfonamide is a useful research reactant for the synthesis of synthesis of 1,?2,?4-?triazol-?3-?imines through stepwise cycloaddition.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P271-P260-P280 |
| Safety Statements | 24/25 |
| HS Code | 29350090 |