BD3409445
3-Chloro-N,N,2-trimethylpropan-1-aminehydrochloride , 98% , 4261-67-0
CAS NO.：4261-67-0
Empirical Formula: C6H15Cl2N
Molecular Weight: 172.1
MDL number: MFCD00012514
EINECS: 224-237-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB129.60 | In Stock |
|
| 25g | RMB440.80 | In Stock |
|
| 100g | RMB1454.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-173 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly), Water (Slightly) |
| form | Powder |
| color | White to off-white |
| Sensitive | Hygroscopic |
| BRN | 4444785 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H14ClN.ClH/c1-6(4-7)5-8(2)3;/h6H,4-5H2,1-3H3;1H |
| InChIKey | SOMIBONUMGNAEP-UHFFFAOYSA-N |
| SMILES | C(C)(CCl)CN(C)C.Cl |
| CAS DataBase Reference | 4261-67-0(CAS DataBase Reference) |
Description and Uses
Cyamemazine intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| HS Code | 29211999 |
