BD4677341
N-(4-Hydroxyphenyl)propionamide , 95% , 1693-37-4
CAS NO.：1693-37-4
Empirical Formula: C9H11NO2
Molecular Weight: 165.19
MDL number: MFCD00791257
EINECS: 216-894-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB393.60 | In Stock |
|
| 250mg | RMB729.60 | In Stock |
|
| 1g | RMB1800.00 | In Stock |
|
| 5g | RMB5348.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-172°C |
| Boiling point: | 389.9±25.0 °C(Predicted) |
| Density | 1.201 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.11±0.26(Predicted) |
| color | White to Pale Purple |
| InChI | InChI=1S/C9H11NO2/c1-2-9(12)10-7-3-5-8(11)6-4-7/h3-6,11H,2H2,1H3,(H,10,12) |
| InChIKey | SSMYTAQHMUHRSK-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=C(O)C=C1)(=O)CC |
| CAS DataBase Reference | 1693-37-4 |
Description and Uses
An Acetaminophen (A161220) impurity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
