BD8882531
Octan-2-yl 2-cyanoacetate , 97% , 52688-08-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5g | RMB55.20 | In Stock |
|
| 10g | RMB89.60 | In Stock |
|
| 25g | RMB180.00 | In Stock |
|
| 100g | RMB604.00 | In Stock |
|
| 500g | RMB2358.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 241.4±8.0 °C(Predicted) |
| Density | 0.951±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.94±0.10(Predicted) |
| Appearance | Colorless to light green Liquid |
| InChI | InChI=1S/C11H19NO2/c1-3-4-5-6-7-10(2)14-11(13)8-9-12/h10H,3-8H2,1-2H3 |
| InChIKey | UHQCFCZBVFECRZ-UHFFFAOYSA-N |
| SMILES | C(OC(C)CCCCCC)(=O)CC#N |
Description and Uses
2-Octyl cyanoacetate is the main raw material for the synthesis of α-cyanoacrylate adhesives. α-Cyanoacrylate adhesives are the earliest discovered and most widely used tissue adhesives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| RIDADR | UN3276 |
| HazardClass | 6.1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
