BD9500431
3,3'-(Oxybis(methylene))bis(3-ethyloxetane) , 95% , 18934-00-4
CAS NO.：18934-00-4
Empirical Formula: C12H22O3
Molecular Weight: 214.3
MDL number:
EINECS: 620-240-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB63.20 | In Stock |
|
| 10g | RMB115.20 | In Stock |
|
| 25g | RMB214.40 | In Stock |
|
| 100g | RMB775.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 275℃ |
| Density | 0.992 |
| Flash point: | 91℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C12H22O3/c1-3-11(5-13-6-11)9-15-10-12(4-2)7-14-8-12/h3-10H2,1-2H3 |
| InChIKey | FNYWFRSQRHGKJT-UHFFFAOYSA-N |
| SMILES | O(CC1(CC)COC1)CC1(CC)COC1 |
| EPA Substance Registry System | Oxetane, 3,3'-[oxybis(methylene)]bis[3-ethyl- (18934-00-4) |
Description and Uses
Mainly for the synthesis of UV polymerization, coatings, and resins. UV-curable monomer material can be used in UV inks, coatings, and UV adhesives; do the raw material of other UV-curable monomers, the nature and function equivalent to OXT-221.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H412-H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P273-P501 |