F211621
L-Glutamic acid monopotassium salt monohydrate , Null , 6382-01-0
CAS NO.：6382-01-0
Empirical Formula: C5H8NO4.K.H2O
Molecular Weight: 203.23
MDL number: MFCD00150343
EINECS: 243-094-0
| Pack Size | Price | Stock | Quantity |
| 250g | RMB509.60 | In Stock |
|
| 1000g | RMB1255.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-118°C |
| form | powder |
| color | white |
| optical activity | [α]20/D +23±1°, c = 5% in 5 M HCl |
| Water Solubility | Soluble in water. |
| BRN | 3637377 |
| InChI | 1S/C5H9NO4.K.H2O/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;1H2/q;+1;/p-1/t3-;;/m0../s1 |
| InChIKey | XIBUKSQTWSKJMQ-QTNFYWBSSA-M |
| SMILES | [K+].[H]O[H].N[C@@H](CCC([O-])=O)C(O)=O |
| CAS DataBase Reference | 6382-01-0 |
Description and Uses
L-Glutamic acid monopotassium salt monohydrate acts as a common excitatory neurotransmitter like the agonist at kainate, N-methyl-D-aspartate receptor (NMDA) and quisqualate receptors in central nervous system. It is also used in cell culture as a component of MEM non-essential amino acids solution..
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | MA1450000 |
| TSCA | Yes |
| HS Code | 29224290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
