LN9414058
(1R,3S,4R)-ent-Entecavir , 98% , 188399-46-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB6025.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >239°C (dec.) |
| Density | 1.81 |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9?+-.0.20(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C12H15N5O3/c1-5-6(3-18)8(19)2-7(5)17-4-14-9-10(17)15-12(13)16-11(9)20/h4,6-8,18-19H,1-3H2,(H3,13,15,16,20)/t6-,7-,8-/m1/s1 |
| InChIKey | QDGZDCVAUDNJFG-BWZBUEFSSA-N |
| SMILES | N1C2=C(N=C(N)NC2=O)N([C@@H]2C[C@@H](O)[C@H](CO)C2=C)C=1 |
Description and Uses
ent-Entecavir is an enantiomeric impurity of the antiviral drug Entecavir (E558900).



![2-AMino-1,9-dihydro-9-[(1S,3R,4S)-4-(hydroxydiMethylsilyl)-3-(hydroxyMethyl)-2-Methylenecyclopentyl]-6H-purin-6-one](https://img.chemicalbook.com/CAS/GIF/870614-82-7.gif)


