PRODUCT Properties
| Melting point: | 265-266℃ |
| Boiling point: | 620.3±55.0 °C(Predicted) |
| Density | 1.11±0.1 g/cm3(Predicted) |
| storage temp. | 4°C, protect from light |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 4.63±0.10(Predicted) |
| color | White to off-white |
| InChIKey | OWVUHYZGACFYHI-SUIRJFICNA-N |
| SMILES | C1(=O)C([C@@]2([H])[C@](C)(CC1)C1C([C@]3([C@@](CC=1)(C)[C@@H]([C@H](C)CCC(=C)C(C)C)[C@H](O)C3)C(O)=O)=CC2)(C)C |&1:3,5,11,12,16,17,26,r| |
| CAS DataBase Reference | 465-18-9 |
Description and Uses
Polyporenic acid C is a lanostane-type triterpenoid isolated from P. cocos. Polyporenic acid C induces cell apoptosis through the death receptor-mediated apoptotic pathway without the involvement of the mitochondria. Polyporenic acid C is promising agent for lung cancer therapy[1].






