M5244835
(6R,7R)-7-Amino-3-Hydroxymethyl-8-Oxo-5-Thia-1-Aza-Bicyclo[4.2.0.]Oct-2-Ene-2-CarboxylicAcid , ≥98% , 15690-38-7
CAS NO.:15690-38-7
Empirical Formula: C11H14N2O6S
Molecular Weight: 302.304
MDL number: MFCD09751258
EINECS: 2397872
| Pack Size | Price | Stock | Quantity |
| 1g | RMB54.40 | In Stock |
|
| 5g | RMB134.40 | In Stock |
|
| 25g | RMB478.40 | In Stock |
|
| 100g | RMB1598.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-107°C |
| Boiling point: | 617.9±55.0 °C(Predicted) |
| Density | 1.74 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 2.68±0.50(Predicted) |
| form | Solid |
| color | White to Beige |
| InChI | InChI=1S/C8H10N2O4S/c9-4-6(12)10-5(8(13)14)3(1-11)2-15-7(4)10/h4,7,11H,1-2,9H2,(H,13,14)/t4-,7-/m1/s1 |
| InChIKey | BQIMPGFMMOZASS-CLZZGJSISA-N |
| SMILES | N12[C@@]([H])([C@H](N)C1=O)SCC(CO)=C2C(O)=O |
Description and Uses
Intermediate in the semi-synthetic cephalosporins synthesis. Found in Acremonium chrysogenum.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P261-P285-P304+P341-P342+P311-P501-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |

![(6R,7R)-7-Amino-3-Hydroxymethyl-8-Oxo-5-Thia-1-Aza-Bicyclo[4.2.0.]Oct-2-Ene-2-CarboxylicAcid](https://img.chemicalbook.com/CAS/GIF/15690-38-7.gif)



