M7257558
magnesium3-hydroxybutyrate , 98% , 586976-57-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB44.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| InChI | InChI=1S/2C4H8O3.Mg/c2*1-3(5)2-4(6)7;/h2*3,5H,2H2,1H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | ZIMQIJFHENOQDO-UHFFFAOYSA-L |
| SMILES | [Mg+2].C([O-])(=O)CC(O)C.C([O-])(=O)CC(O)C |
Description and Uses
3-Hydroxybutyric acid magnesium salt is a natural metabolite formed during fat digestion and metabolism, and is called ketone body. Just as glucose is an energy molecule derived from carbohydrates / sugars, while amino acids are derived from proteins, ketones are energy molecules derived from fats.
Magnesium 3-hydroxybutyrate is an energy-intensive molecule that naturally provides energy to your brain, heart and muscles during low carbohydrate intake.
Magnesium 3-hydroxybutyrate is a dietary supplement ingredient and is generally recognized as safe food (GRAS).
