PRODUCT Properties
| Melting point: | 222-228℃ |
| Boiling point: | 637.2±55.0 °C(Predicted) |
| Density | 1.349 |
| storage temp. | 2-8°C |
| solubility | DMF: 10 mg/ml; DMSO: 20 mg/ml; DMSO:PBS (pH 7.2) (1:8): 0.11 mg/ml |
| form | A crystalline solid |
| pka | 12.39±0.70(Predicted) |
| color | White to off-white |
| InChIKey | JGDCRWYOMWSTFC-GSXUXUDRNA-N |
| SMILES | [C@]12(C)C(=O)[C@H]([C@]3([H])[C@@]4(C)CC[C@H](O)C[C@@]4([H])CC[C@@]3([H])[C@@]1(O)CC[C@@H]2C1=COC(=O)C=C1)O |&1:0,4,5,7,11,14,18,20,24,r| |
Description and Uses
Arenobufagin is a cardiotoxic bufanolide steroid secreted by the Argentine toad Bufo arenarum. It has effects similar to digitalis, blocking the Na+/K+ pump in heart tissue.




