S353180
α-Ketoglutaric acid potassium salt , ≥98%(enzymatic) , 997-43-3
Synonym(s):
2-Oxopentanedioic acid potassium salt
CAS NO.：997-43-3
Empirical Formula: C5H5KO5
Molecular Weight: 184.19
MDL number: MFCD00064195
EINECS: 213-641-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB705.37 | In Stock |
|
| 25g | RMB1390.64 | In Stock |
|
| 100g | RMB4010.08 | In Stock |
|
| 1kg | RMB20086.70 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.74 g/cm3 |
| storage temp. | 2-8°C |
| form | powder |
| color | White to off-white |
| Water Solubility | water: 100mg/mL, clear, colorless to faintly yellow |
| InChI | InChI=1S/C5H6O5.K/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);/q;+1/p-1 |
| InChIKey | XTCZBVVKDHLWKU-UHFFFAOYSA-M |
| SMILES | [K+].C(O)(=O)C(=O)CCC([O-])=O |
| CAS DataBase Reference | 997-43-3(CAS DataBase Reference) |
Description and Uses
2-Ketoglutaric Acid Monopotassium Salt can be used as antithrombin for coating organs during transplantation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362-P403+P233-P501 |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| WGK Germany | 3 |
