PRODUCT Properties
| Melting point: | 100-102 °C(lit.) |
| Boiling point: | 270 °C(lit.) |
| Density | 1.2979 (rough estimate) |
| refractive index | 1.5640 (estimate) |
| Flash point: | 270°C |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 637861 |
| InChI | InChI=1S/C8H6Cl2O/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2 |
| InChIKey | FWDFNLVLIXAOMX-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Cl)C=C1)CCl |
| CAS DataBase Reference | 937-20-2(CAS DataBase Reference) |
Description and Uses
2,4′-Dichloroacetophenone (4-chlorophenacyl chloride) may be used in the synthesis of chiral chlorohydrin by asymmetric reduction., It may be used as an alkylating agent in the Williamson reaction of 7-hydroxycoumarins to form substituted oxoethers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HS Code | 29147000 |
