A0270056
2,2′-Dibromobiphenyl , 99% , 13029-09-9
CAS NO.:13029-09-9
Empirical Formula: C12H8Br2
Molecular Weight: 312
MDL number: MFCD00093707
EINECS: 625-732-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5g | RMB63.20 | In Stock |
|
| 25g | RMB223.20 | In Stock |
|
| 100g | RMB879.20 | In Stock |
|
| 500g | RMB3919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-83 °C |
| Boiling point: | 332.9±17.0 °C(Predicted) |
| Density | 1.667 |
| vapor pressure | 0.007-0.27Pa at 20-50℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetone (Sparingly), Benzene (Sparingly), Ethyl Acetate (Slightly) |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C12H8Br2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
| InChIKey | DRKHIWKXLZCAKP-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2Br)=CC=CC=C1Br |
| LogP | 4.6 at 25℃ and pH6.2 |
| CAS DataBase Reference | 13029-09-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,1'-Biphenyl, 2,2'-dibromo- (13029-09-9) |
Description and Uses
2,2'-Dibromobiphenyl is used to produce 5,5-dimethyl-5H-dibenzosilole at the temperature of -78 - 20°C. It will need reagent n-BuLi and solvents diethyl ether, hexane.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-50/53-22 |
| Safety Statements | 37/39-26-61-60-36/37 |
| RIDADR | UN3152 |
| WGK Germany | 3 |
| HazardClass | 9 |
| PackingGroup | II |
| HS Code | 29039990 |








