PRODUCT Properties
| Melting point: | 195 °C |
| Boiling point: | 160℃/6mm |
| Density | 1.617±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 16.43±0.30(Predicted) |
| form | Solid |
| color | White |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C12H8BrN/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7,14H |
| InChIKey | LTBWKAYPXIIVPC-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C2=C1C=CC(Br)=C2 |
| EPA Substance Registry System | 3-Bromocarbazole (1592-95-6) |
Description and Uses
3-Bromo-9H-carbazole is an isomer to 2-Bromo-9H-carbazole, with the only difference being that 9H-carbazole is mono-brominated at 3-position. Blocked at 3-position, 3-Bromo-9H-carbazole derivatives reduce the chance of being oxidised to form excimers or oligomers. 3-bromo-9H-carbazole is a versatile building block that can be used to create a range of compounds, such as 9-Benzyl-3-bromo-9H-carbazole. 3-Bromo-9H-carbazole can be prepared by reacting 9H-carbzole with N-bromosuccinimide (NBS) In tetrahydrofuran at room temperature[1].
3-Bromo-9H-carbazole is an aryl hydrocarbon receptor agonist. A standard for environmental testing and research. Substance for the bological potency study, characterization of mono to tetra-halogenated carbazoles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
