A0375056
1,1,3,3-Tetraethoxypropane , ≥95% , 122-31-6
Synonym(s):
1,1,3,3-Tetraethoxypropane, Malondialdehyde tetraethyl acetal;Malonaldehyde bis(diethyl acetal);Malondialdehyde bis (diethyl acetal);TEP
CAS NO.:122-31-6
Empirical Formula: C11H24O4
Molecular Weight: 220.31
MDL number: MFCD00009240
EINECS: 204-533-1
| Pack Size | Price | Stock | Quantity |
| 25ml | RMB143.20 | In Stock |
|
| 100ml | RMB423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -90 °C |
| Boiling point: | 220 °C (lit.) |
| Density | 0.919 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 190 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | insoluble |
| BRN | 1209619 |
| InChI | InChI=1S/C11H24O4/c1-5-12-10(13-6-2)9-11(14-7-3)15-8-4/h10-11H,5-9H2,1-4H3 |
| InChIKey | KVJHGPAAOUGYJX-UHFFFAOYSA-N |
| SMILES | C(OCC)(OCC)CC(OCC)OCC |
| CAS DataBase Reference | 122-31-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Propane, 1,1,3,3-tetraethoxy-(122-31-6) |
Description and Uses
1,1,3,3-Tetraethoxypropane has been used in the preparation of diazabicyclodecenes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36/37/39-26-24/25 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| RTECS | ON8750000 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29110000 |
| Toxicity | LD50 orally in Rabbit: 1610 mg/kg |





