A0468456
2-Naphthylboronicacid(containsvaryingamountsofAnhydride) , 99% , 32316-92-0
Synonym(s):
2-Naphthaleneboronic acid
CAS NO.:32316-92-0
Empirical Formula: C10H9BO2
Molecular Weight: 171.99
MDL number: MFCD00236051
EINECS: 628-070-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB39.20 | In Stock |
|
| 25g | RMB148.00 | In Stock |
|
| 100g | RMB527.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 269-275 °C(lit.) |
| Boiling point: | 381.9±25.0 °C(Predicted) |
| Density | 1.21±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Water Solubility | Slightly soluble in water |
| pka | 8.53±0.30(Predicted) |
| form | Crystalline Powder and/or Chunks |
| color | White to off-white |
| BRN | 2936449 |
| InChI | InChI=1S/C10H9BO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,12-13H |
| InChIKey | KPTRDYONBVUWPD-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1B(O)O |
| CAS DataBase Reference | 32316-92-0(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29319090 |



