A0475556
OxyfluorfenSolutioninMethanol , 1000μg/mLinMethanol,uncertainty2%
CAS NO.:
Empirical Formula: C15H11ClF3NO4
Molecular Weight: 361.7
MDL number: MFCD00072435
EINECS: 255-983-0
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB231.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-84°C |
| Boiling point: | >240°C |
| Density | 1.3500 |
| Flash point: | -18 °C |
| storage temp. | APPROX 4°C |
| solubility | DMSO : 100 mg/mL (276.47 mM; Need ultrasonic) |
| form | Solid |
| color | Orange crystal solid |
| Water Solubility | 117ug/L(temperature not stated) |
| BRN | 2065259 |
| Major Application | agriculture environmental |
| InChI | 1S/C15H11ClF3NO4/c1-2-23-14-8-10(4-5-12(14)20(21)22)24-13-6-3-9(7-11(13)16)15(17,18)19/h3-8H,2H2,1H3 |
| InChIKey | OQMBBFQZGJFLBU-UHFFFAOYSA-N |
| SMILES | CCOc1cc(Oc2ccc(cc2Cl)C(F)(F)F)ccc1[N+]([O-])=O |
| LogP | 4.730 |
| CAS DataBase Reference | 42874-03-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2-chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)-(42874-03-3) |
| EPA Substance Registry System | Oxyfluorfen (42874-03-3) |
Description and Uses
Oxyfluorfen is a semi-solid at room temperature, red-brown to yellow, faint smoky odor.
Oxyfluorfen is a diphenyl ether broad spectrum herbicide. Oxyfluorfen is a pre- and post-emergent control broad leaf and grassy weeds in field crops.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | F,Xn,N |
| Risk Statements | 11-38-50/53-65-67 |
| Safety Statements | 60-61-62 |
| RIDADR | UN 1145 3/PG 2 |
| WGK Germany | 2 |
| RTECS | KN6900000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 42874-03-3(Hazardous Substances Data) |
| Toxicity | LD50 orally in male albino rats: >5000 mg/kg (Yih, Swithenbank) |



![Sulfamic acid, N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-, 2-ethoxyphenyl ester](https://img.chemicalbook.com/CAS/GIF/126801-58-9.gif)
