PRODUCT Properties
| Boiling point: | 55-56 °C/2 mmHg (lit.) |
| Density | 0.827 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 170 °F |
| storage temp. | Storage temp. 2-8°C |
| solubility | sol common organic solvents. |
| form | liquid |
| color | colorless |
| Specific Gravity | 0.827 |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 1850371 |
| InChI | 1S/C10H28Si3/c1-11(2,3)10(12(4,5)6)13(7,8)9/h10H,1-9H3 |
| InChIKey | BNZSPXKCIAAEJK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C([Si](C)(C)C)[Si](C)(C)C |
| CAS DataBase Reference | 1068-69-5 |
Description and Uses
Tris(trimethylsilyl)methane is precursor of (Me3Si)3CLi, useful to introduce bulky tris(trimethylsilyl)methyl (trisyl) group; Peterson alkenation reagent. It takes part in the reactions of Synthesis of Tris(trimethylsilyl)methyl Bromide, Metalation, Formation of Bis(trimethylsilyl)methyllithium, Hydrosilylation of Double Bonds, Intramolecular Reactions, Intermolecular Reactions, Nonradical Reactions etc.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





