A0515156
9,9-dimethyl-9,10-dihydroacridine , 6267-02-3
CAS NO.：6267-02-3
Empirical Formula: C15H15N
Molecular Weight: 209.29
MDL number: MFCD00030130
EINECS: 228-436-9
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB271.20 | In Stock |
|
| 1g | RMB1023.20 | In Stock |
|
| 5g | RMB4423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-126℃ |
| Boiling point: | 155°C/1mmHg(lit.) |
| Density | 1.043±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 2.05±0.40(Predicted) |
| color | White to Almost white |
| λmax | 284nm(CH3CN)(lit.) |
| InChI | InChI=1S/C15H15N/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h3-10,16H,1-2H3 |
| InChIKey | JSEQNGYLWKBMJI-UHFFFAOYSA-N |
| SMILES | C1=C2C(NC3=C(C2(C)C)C=CC=C3)=CC=C1 |
| EPA Substance Registry System | Acridine, 9,10-dihydro-9,9-dimethyl- (6267-02-3) |
Description and Uses
9,9-Dimethyl-9,10-dihydroacridine are currently being used in the development of thermally activated delayed fluorescence (TADF) molecules which are being researched for their possible efficient deep-blue TADF emitting potential.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
