A0533156
MetazachlorSolutioninAcetonitrile , 100 μg/mlinetonitrile, uncertainty of 3 % , 67129-08-2
CAS NO.:67129-08-2
Empirical Formula: C14H16ClN3O
Molecular Weight: 277.75
MDL number: MFCD00055509
EINECS: 266-583-0
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB63.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-78°C |
| Boiling point: | 439.2±45.0 °C(Predicted) |
| Density | 1.237-1.323 g/cm3(Temp: 25 °C) |
| Flash point: | 2 °C |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform, Methanol |
| pka | 1.54±0.10(Predicted) |
| form | Solid |
| color | Off-White to Pale Beige |
| BRN | 621550 |
| Major Application | agriculture environmental |
| InChI | 1S/C14H16ClN3O/c1-11-5-3-6-12(2)14(11)18(13(19)9-15)10-17-8-4-7-16-17/h3-8H,9-10H2,1-2H3 |
| InChIKey | STEPQTYSZVCJPV-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1N(Cn2cccn2)C(=O)CCl |
| LogP | 2.130 |
| CAS DataBase Reference | 67129-08-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetamide, 2-chloro-n-(2,6-dimethylphenyl)-n-(1h-pyrazol-1-ylmethyl)-(67129-08-2) |
Description and Uses
A chloroacetanilide herbicide used on vegetable crops.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H351-H410 |
| Precautionary statements | P201-P273-P280-P301+P312-P302+P352-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,F |
| Risk Statements | 22-36-20/21/22-11-43 |
| Safety Statements | 36-26-16-36/37 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| RTECS | AB5442000 |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Skin Sens. 1 |









