A0536956
                    ThidiazuronSolutioninMethanol , 1000 μg/mlinmethanol, uncertainty 2%
                            Synonym(s):
1-Phenyl-3-(1,2,3-thiadiazol-5-yl)urea;TDZ
                            
                        
                CAS NO.:
Empirical Formula: C9H8N4OS
Molecular Weight: 220.25
MDL number: MFCD00078723
EINECS: 257-356-7
| Pack Size | Price | Stock | Quantity | 
| 1.2ml | RMB159.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 213°C | 
                                    
| Density | 1.3493 (rough estimate) | 
                                    
| refractive index | 1.6390 (estimate) | 
                                    
| storage temp. | Sealed in dry,2-8°C | 
                                    
| solubility | Soluble in DMSO | 
                                    
| pka | 12.06±0.70(Predicted) | 
                                    
| form | Solid | 
                                    
| color | Light yellow to yellow | 
                                    
| Merck | 13,9384 | 
                                    
| BRN | 1078092 | 
                                    
| InChI | InChI=1S/C9H8N4OS/c14-9(12-8-6-10-13-15-8)11-7-4-2-1-3-5-7/h1-6H,(H2,11,12,14) | 
                                    
| InChIKey | HFCYZXMHUIHAQI-UHFFFAOYSA-N | 
                                    
| SMILES | N(C1=CC=CC=C1)C(NC1SN=NC=1)=O | 
                                    
| CAS DataBase Reference | 51707-55-2(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | Thidiazuron (51707-55-2) | 
                                    
Description and Uses
Thidiazuron is a non-purine containing urea derivative with cytokinin activity. Thidiazuron is used as a cotton defoliant and a plant growth regulator in tissue culture.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335-H410 | 
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi,N | 
| Risk Statements | 36/37/38-51/53 | 
| Safety Statements | 22-26-36-61 | 
| RIDADR | UN 3077 9 / PGIII | 
| WGK Germany | 3 | 
| RTECS | YU1395000 | 
| HS Code | 2934999090 | 
| Hazardous Substances Data | 51707-55-2(Hazardous Substances Data) | 
| Toxicity | LC50 (96-hour) for bluegill sun?sh, channel cat?sh and rainbow trout >1,000 mg/L (Hartley and Kidd, 1987); acute oral LD50 for rats >5,000 mg/kg (Hartley and Kidd, 1987), 5,350 mg/kg (RTECS, 1985). | 




