A0539756
AECSubstrateBuffer,10X , 10Xconcentrate
Synonym(s):
3-Amino-9-ethylcarbazole, 3AC;9-Ethylcarbazol-3-amine;AEC
CAS NO.：
Empirical Formula: C14H14N2
Molecular Weight: 210.27
MDL number: MFCD00004964
EINECS: 205-057-7
| Pack Size | Price | Stock | Quantity |
| 50ml | RMB568.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-88 °C(lit.) |
| Boiling point: | 355C |
| Density | 1,15g/cm |
| refractive index | 1.6180 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | tablet |
| pka | 4.99±0.30(Predicted) |
| color | Brown to Very Dark Brown |
| BRN | 174969 |
| InChI | InChI=1S/C14H14N2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16/h3-9H,2,15H2,1H3 |
| InChIKey | OXEUETBFKVCRNP-UHFFFAOYSA-N |
| SMILES | N1(CC)C2=C(C=CC=C2)C2=C1C=CC(N)=C2 |
| CAS DataBase Reference | 132-32-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 9H-carbazol-3-amine, 9-ethyl-(132-32-1) |
| EPA Substance Registry System | 3-Amino-9-ethylcarbazole (132-32-1) |
Description and Uses
3-Amino-9-ethylcarbazole (AEC) has been used as a chromogen in immunohistochemistry to visualize the cells. It has also been used as a substrate in enzyme-linked immune absorbent spot (ELISpot).
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H350 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38-40-23/24/25-45 |
| Safety Statements | 45-36/37/39-26-22-53 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | FE3590000 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Hazardous Substances Data | 132-32-1(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
