A0557056
4'-Bromotri(4-biphenylyl)amine , 99% , 728039-63-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB121.60 | In Stock |
|
| 5g | RMB327.20 | In Stock |
|
| 25g | RMB895.20 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225.0 to 229.0 °C |
| Boiling point: | 703.3±60.0 °C(Predicted) |
| Density | 1.277±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -3.44±0.60(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C36H26BrN/c37-33-19-11-29(12-20-33)32-17-25-36(26-18-32)38(34-21-13-30(14-22-34)27-7-3-1-4-8-27)35-23-15-31(16-24-35)28-9-5-2-6-10-28/h1-26H |
| InChIKey | VBQIVFTUXFKGKW-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(N(C2=CC=C(C3=CC=CC=C3)C=C2)C2=CC=C(C3=CC=C(Br)C=C3)C=C2)C=C1 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2921511990 |






![N-([1,1'-Biphenyl]-4-yl)-[1,1'-biphenyl]-3-amine](https://img.chemicalbook.com/CAS/20180527/GIF/570391-47-8.gif)
![N-[4-(2-Naphthalenyl)phenyl]-[1,1'-biphneyl]-4-amine](https://img.chemicalbook.com/CAS/20180531/GIF/897921-60-7.gif)