A0563856
2-bromodibenzofuran , 99% , 86-76-0
CAS NO.:86-76-0
Empirical Formula: C12H7BrO
Molecular Weight: 247.09
MDL number: MFCD00092338
EINECS: 659-733-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB39.20 | In Stock |
|
| 25g | RMB111.20 | In Stock |
|
| 100g | RMB423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-122℃ |
| Boiling point: | 344℃ |
| Density | 1.577 |
| refractive index | 1.5290 (estimate) |
| Flash point: | 162℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in hot methanol. |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C12H7BrO/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7H |
| InChIKey | CRJISNQTZDMKQD-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C2=CC(Br)=CC=C12 |
Description and Uses
2-Bromo-dibenzofuran is the bromo modified form of dibenzofuran, an aromatic compound consisting two benzene rings fused to a central furan ring. It can be used as a reagent in Friedel-Crafts acylation reactions.
2-Bromodibenzofuran is used as a reagent in Friedel-Crafts acylation reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H413 |
| Precautionary statements | P264-P280i-P301+P312a-P305+P351+P338-P337+P313-P501a |
| Risk Statements | 22-36-53 |
| Safety Statements | 26-36-60-61 |
| HS Code | 29329990 |





