A0567356
BuprofezinSolutioninMethanol , 1000 μg/mlinmethanol, uncertainty 2%
CAS NO.:
Empirical Formula: C16H23N3OS
Molecular Weight: 305.44
MDL number: MFCD01681899
EINECS: 614-948-3
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-106°C |
| alpha | 22 º (c=8,6N HCl) |
| Boiling point: | 273°C (12 torr) |
| Density | 1.18 |
| vapor pressure | 1.25 x l0-3 Pa (25 °C) |
| refractive index | 1.52-1.522 |
| Flash point: | 176-178°C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 3.02±0.20(Predicted) |
| form | Solid |
| color | White to Pale Beige |
| Water Solubility | 0.9 mg/L at 20 ºC |
| Decomposition | 176-178 ºC |
| BRN | 8324923 |
| Major Application | agriculture environmental |
| InChI | 1S/C16H23N3OS/c1-12(2)19-14(17-16(3,4)5)21-11-18(15(19)20)13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3/b17-14+ |
| InChIKey | PRLVTUNWOQKEAI-SAPNQHFASA-N |
| SMILES | CC(C)N1C(=O)N(CS\C1=N\C(C)(C)C)c2ccccc2 |
| CAS DataBase Reference | 69327-76-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4H-1,3,5-thiadiazin-4-one, 2-((1,1-dimethylethyl)imino)tetrahydro-3-(1-methylethyl)-5-phenyl-(69327-76-0) |
| EPA Substance Registry System | Buprofezin (69327-76-0) |
Description and Uses
Buprofezin is a contact and ingested insecticide, active against Homoptera (whiteflies, leafhoppers, scale insects, etc.) in and on citrus, cotton, cucumbers, tomatoes, sweet potatoes, rice, etc.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H373-H410 |
| Precautionary statements | P260-P273-P314-P391-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| RIDADR | UN3077(solid) |
| WGK Germany | 2 |
| RTECS | XI2865000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| Hazardous Substances Data | 69327-76-0(Hazardous Substances Data) |
| Toxicity | LD50 in mice, rats (mg/kg): 10000, 8740 orally; LC50 (48 hr) in carp: 2-10 mg/l (Kanno, 1981) |




