1-Butyl-3-methylimidazoliumchloride , 98% , 79917-90-1
Synonym(s):
N-Butyl-N′-methylimidazolium chloride;1-Methyl-3-butylimidazolium chloride;BMIMCl
CAS NO.:79917-90-1
Empirical Formula: C8H15ClN2
Molecular Weight: 174.67
MDL number: MFCD03095425
EINECS: 460-120-8
| Pack Size | Price | Stock | Quantity |
| 10g | RMB31.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | ~70 °C |
| Density | d25 1.08 (dried) |
| Flash point: | 192 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Mass |
| color | Cream to yellow |
| Water Solubility | Soluble in acetone, acetonitrile, hot ethyl acetate, isopropyl alcohol, methylene chloride and methanol. Insoluble in water, hexane and toluene, |
| Sensitive | Hygroscopic |
| BRN | 6449277 |
| Stability: | hygroscopic |
| InChI | InChI=1S/C8H15N2.ClH/c1-3-4-5-10-7-6-9(2)8-10;/h6-8H,3-5H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FHDQNOXQSTVAIC-UHFFFAOYSA-M |
| SMILES | N1(CCCC)C=C[N+](C)=C1.[Cl-] |
| CAS DataBase Reference | 79917-90-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Imidazolium, 3-butyl-1-methyl-, chloride (1:1) (79917-90-1) |
Description and Uses
1-butyl-3-methylimidazolium chloride is a highly efficient direct solvent for the dissolution and regeneration of cellulose. During the precipitation of the regenerated cellulose, large volumes of dilute IL aqueous solutions are produced. This compound, an imidazolium-based ionic liquid, is considered the representative emerging persistent aquatic pollutant, and its environmental toxicity has attracted growing concern[1].
1-Butyl-3-methylimidazolium chloride in combination with aluminium chloride forms an organoaluminate molten salt, which can act as an acidic catalyst for the alkylation of isobutane with 2-butene.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H411 |
| Precautionary statements | P264-P270-P273-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | T,N |
| Risk Statements | 25-36/37/38-51/53-36/38 |
| Safety Statements | 26-45-61-22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29332900 |





