A0600412
N-Acetyl-L-phenylalanine , 99% , 2018-61-3
CAS NO.:2018-61-3
Empirical Formula: C11H13NO3
Molecular Weight: 207.23
MDL number: MFCD00063158
EINECS: 217-959-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB120.00 | In Stock |
|
| 100G | RMB302.40 | In Stock |
|
| 500G | RMB583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-173 °C(lit.) |
| alpha | 40 º (c=1,methanol) |
| Boiling point: | 346.25°C (rough estimate) |
| Density | 1.1878 (rough estimate) |
| refractive index | 40 ° (C=5, MeOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility in methanol (almost transparency). Soluble in acetone and ethanol (20 mg/ ml). |
| pka | 3.56±0.10(Predicted) |
| form | Fine Crystalline Powder or Needles |
| color | White to off-white |
| optical activity | [α]22/D +40.0°, c = 1 in methanol |
| Major Application | peptide synthesis |
| InChI | 1S/C11H13NO3/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 |
| InChIKey | CBQJSKKFNMDLON-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(O)=O |
| CAS DataBase Reference | 2018-61-3(CAS DataBase Reference) |
| NIST Chemistry Reference | L-phenylalanine, n-acetyl-(2018-61-3) |
| EPA Substance Registry System | L-Phenylalanine, N-acetyl- (2018-61-3) |
Description and Uses
N-Acetyl-L-phenylalanine is an protected analogue of L-Phenylalanine (P319415), an essential amino acid produced for medical, feed, and nutritional applications such as in the preparation of Aspartame.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |




