A0600512
o-Arsanilic acid , 98% , 2045-00-3
Synonym(s):
2-Aminobenzenearsonic acid
CAS NO.:2045-00-3
Empirical Formula: C6H8AsNO3
Molecular Weight: 217.05
MDL number: MFCD00007630
EINECS: 218-064-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-155 °C(lit.) |
| Boiling point: | 519.3±52.0 °C(Predicted) |
| Density | 1.79 g/cm3 |
| solubility | 1 M NH4OH: soluble50mg/mL, clear to turbid (orange-brown) |
| form | solid |
| pka | pK1: ca 2;pK2: 3.77;pK3: 8.66 (25°C) |
| color | White to Light yellow to Light orange |
| Stability: | Hygroscopic, Moisture sensitive |
| InChI | InChI=1S/C6H8AsNO3/c8-6-4-2-1-3-5(6)7(9,10)11/h1-4H,8H2,(H2,9,10,11) |
| InChIKey | LQCOCUQCZYAYQK-UHFFFAOYSA-N |
| SMILES | [As](C1=CC=CC=C1N)(O)(O)=O |
| CAS DataBase Reference | 2045-00-3(CAS DataBase Reference) |
| NIST Chemistry Reference | O-arsanilic acid(2045-00-3) |
Description and Uses
o-Arsanilic Acid is an organoarsenic compound. o-Arsanilic Acid is a highly toxic contaminant and can be found in plants growing in contaminated soil.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H410 |
| Precautionary statements | P261-P304+P340+P312-P403+P233-P264-P270-P271-P273-P301+P310+P330-P304+P340+P311-P391-P405-P501 |
| Hazard Codes | T,N |
| Risk Statements | 23/25-50/53 |
| Safety Statements | 20/21-28-45-60-61-28A |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HS Code | 2931.90.6000 |
| HazardClass | 6.1 |
| PackingGroup | III |





