A0600912
(+)-Abscisic acid , 98% , 21293-29-8
Synonym(s):
(+)-Abscisic Acid - CAS 21293-29-8 - Calbiochem;(+)-cis,trans-Abscisic Acid, S-ABA;(S)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-(2Z,4E)-pentadienoic acid;ABA;Dormin
CAS NO.:21293-29-8
Empirical Formula: C15H20O4
Molecular Weight: 264.32
MDL number: MFCD00066545
EINECS: 244-319-5
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB95.20 | In Stock |
|
| 250MG | RMB319.20 | In Stock |
|
| 1G | RMB1038.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188 °C |
| alpha | D20 +411.1° (c = 1 in ethanol); D20 +426.5° (c = 1 in 0.005N methanolic H2SO4) |
| Boiling point: | 327.55°C (rough estimate) |
| Density | 1.0583 (rough estimate) |
| refractive index | 410 ° (C=0.2, EtOH) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethanol (Sparingly), Methanol (Slightly) |
| form | Off-white powder |
| pka | 4.87±0.33(Predicted) |
| color | White to Pale Yellow |
| optical activity | [α]/D 415±10°, c = 0.1 in ethanol |
| Merck | 14,11 |
| BRN | 2698956 |
| Stability: | Light Sensitive |
| InChI | 1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m1/s1 |
| InChIKey | JLIDBLDQVAYHNE-WEYXYWBQSA-N |
| SMILES | CC(\C=C\[C@@]1(O)C(C)=CC(=O)CC1(C)C)=C\C(O)=O |
| LogP | 1.896 (est) |
| CAS DataBase Reference | 21293-29-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4-Pentadienoic acid, 5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl]-3-methyl-, (2Z,4E)- (21293-29-8) |
Description and Uses
(+)-Abscisic acid is the natural isomer of the abscission-accelerating plant hormone and a plant growth regulator that exhibits multiple physiological effects, including inducing plant dormancy, inhibiting seed germination and plant growth, and stimulating stomatal closure.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | RZ2475100 |
| F | 8 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |




