A0603012
Acetoxyacetyl chloride , 97% , 13831-31-7
CAS NO.:13831-31-7
Empirical Formula: C4H5ClO3
Molecular Weight: 136.53
MDL number: MFCD00011535
EINECS: 237-542-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB69.60 | In Stock |
|
| 100G | RMB263.20 | In Stock |
|
| 500g | RMB1259.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-160 °C |
| Boiling point: | 55 °C/12 mmHg (lit.) |
| Density | 1.27 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 160 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.270 |
| color | Clear colorless to pale yellow |
| Water Solubility | Reacts with water violently. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C4H5ClO3/c1-3(6)8-2-4(5)7/h2H2,1H3 |
| InChIKey | HZDNNJABYXNPPV-UHFFFAOYSA-N |
| SMILES | C(Cl)(COC(C)=O)=O |
| CAS DataBase Reference | 13831-31-7(CAS DataBase Reference) |
Description and Uses
Acetoxyacetyl chloride was used in synthesis of stabilized axial and equatorial conformers of spiro-β-lactams?and glycolylhydroxamic acids.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34-36/37 |
| Safety Statements | 23-26-27-36/37/39-45-8 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | N |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29183000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








