A0603312
4-Amino-3-hydrazino-5-mercapto-1,2,4-triazole , AR,95% , 1750-12-5
Synonym(s):
4-Amino-3-hydrazino-5-mercapto-1,2,4-triazole;4-Amino-5-hydrazino-1,2,4-triazole-3-thiol
CAS NO.:1750-12-5
Empirical Formula: C2H6N6S
Molecular Weight: 146.17
MDL number: MFCD00003098
EINECS: 217-135-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5G | RMB140.00 | In Stock |
|
| 25G | RMB520.00 | In Stock |
|
| 100g | RMB1407.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-230 °C (dec.)(lit.) |
| Boiling point: | 275.0±23.0 °C(Predicted) |
| Density | 2.31±0.1 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | Soluble in Dimethyl sulfoxide. (DMSO) |
| pka | 8.52±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 134867 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C2H6N6S/c3-5-1-6-7-2(9)8(1)4/h3-4H2,(H,5,6)(H,7,9) |
| InChIKey | RDIMQHBOTMWMJA-UHFFFAOYSA-N |
| SMILES | N1=C(NN)N(N)C(=S)N1 |
| CAS DataBase Reference | 1750-12-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2,4-Triazolidin-3-one, 4-amino-5-thioxo-, hydrazone (1750-12-5) |
Description and Uses
A reagent for the determination of aldehydes and other reactive chemicals
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H228 |
| Precautionary statements | P210-P240-P241-P280-P370+P378 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1325 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 4.1A - Other explosive hazardous materials |
| Hazard Classifications | Flam. Sol. 1 |







