A0603512
L-Alanine methyl ester hydrochloride , 98% , 2491-20-5
CAS NO.:2491-20-5
Empirical Formula: C4H10ClNO2
Molecular Weight: 139.58
MDL number: MFCD00063663
EINECS: 219-652-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB111.20 | In Stock |
|
| 500g | RMB463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109-111 °C(lit.) |
| alpha | 7 º (c=2, CH3OH 24 ºC) |
| refractive index | 6.5 ° (C=2, MeOH) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Powder |
| color | White to off-white |
| optical activity | [α]25/D +7.0°, c = 1.6 in methanol |
| Water Solubility | Soluble in Water (100 mg/ml). |
| Sensitive | Hygroscopic |
| BRN | 3594033 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C4H9NO2.ClH/c1-3(5)4(6)7-2;/h3H,5H2,1-2H3;1H/t3-;/s3 |
| InChIKey | IYUKFAFDFHZKPI-OQFXAWDINA-N |
| SMILES | C(=O)(OC)[C@@H](N)C.Cl |&1:4,r| |
| CAS DataBase Reference | 2491-20-5(CAS DataBase Reference) |
Description and Uses
L-Alanine methyl ester hydrochloride is used to make in-vivo measurement of glucose and alanine metabolism in studies of patients with diabetes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| REACH Registrations | Active |





