A0606512
3-(2-Naphthyl)-D-alanine·HCl , 98% , 76985-09-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB84.80 | In Stock |
|
| 5G | RMB309.60 | In Stock |
|
| 25G | RMB1291.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 355.53°C (rough estimate) |
| Density | 1.1242 (rough estimate) |
| refractive index | 13 ° (C=1, 1mol/L HCl) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 2.21±0.30(Predicted) |
| form | Solid |
| color | Off-white |
| optical activity | Consistent with structure |
| InChI | InChI=1/C13H13NO2/c14-12(13(15)16)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7,12H,8,14H2,(H,15,16)/t12-/s3 |
| InChIKey | JPZXHKDZASGCLU-PLAQIDKDNA-N |
| SMILES | C(C1C=CC2C=CC=CC=2C=1)[C@@H](N)C(=O)O |&1:11,r| |
| CAS DataBase Reference | 76985-09-6(CAS DataBase Reference) |
Description and Uses
H-D-2-Nal-OH is an alanine derivative[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
