A0607112
4-Androstene-3,17-dione , 99% , 63-05-8
CAS NO.:63-05-8
Empirical Formula: C19H26O2
Molecular Weight: 286.41
MDL number: MFCD00003615
EINECS: 200-554-5
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB63.20 | In Stock |
|
| 1G | RMB88.00 | In Stock |
|
| 5g | RMB316.80 | In Stock |
|
| 25g | RMB827.20 | In Stock |
|
| 100g | RMB2364.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-171 °C(lit.) |
| alpha | D30 +199° (in chloroform) |
| Boiling point: | 368.77°C (rough estimate) |
| Density | 1.0655 (rough estimate) |
| refractive index | 1.4709 (estimate) |
| Flash point: | 2℃ |
| storage temp. | Controlled Substance, -20°C Freezer |
| solubility | Chloroform (Slightly), Ethanol (Slightly, Sonicated), Methanol (Sparingly) |
| form | Solid |
| color | Dimorphous: Needles from acetone, or crystalsfrom hexane |
| Water Solubility | 57.28mg/L(25 ºC) |
| Merck | 13,643 |
| InChI | 1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | AEMFNILZOJDQLW-QAGGRKNESA-N |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]4(C)C(=O)CC[C@@]24[H] |
| CAS DataBase Reference | 63-05-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Androst-4-ene-3,17-dione(63-05-8) |
| EPA Substance Registry System | 4-Androstenedione (63-05-8) |
Description and Uses
Androstenedione (CRM) (Item No. ISO60161) is a certified reference material categorized as an anabolic androgenic steroid. Androstenedione is a precursor of testosterone (Item Nos. ISO60154 | ISO00154 | 15645) and estrone . Androstenedione is regulated as a Schedule III compound in the United States. Androstenedione (CRM) (Item No. ISO60161) is provided as a DEA exempt preparation. This product is intended for research and forensic applications.
Testosterone precursor and metabolite with androgenic activity. Controlled substance (anabolic sterid)
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P261-P280-P305+P351+P338-P370+P378-P403+P235 |
| Hazard Codes | Xn,T,F |
| Risk Statements | 40-64-52-22-61-60-36-20/21/22-11 |
| Safety Statements | 22-24/25-36-45-36/37-53-26-16 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 3 |
| RTECS | BV8150000 |
| HS Code | 29372900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Lact. Repr. 1A |
| Hazardous Substances Data | 63-05-8(Hazardous Substances Data) |







