A0607412
Allylpalladium(II) chloride dimer , Pd58.2% , 12012-95-2
Synonym(s):
Allylpalladium(II) chloride dimer;Bis(allyl)dichlorodipalladium;Bis(allyl)dichloropalladium;Bis(allylchloropalladium);Diallyldichlorodipalladium
CAS NO.:12012-95-2
Empirical Formula: C6H10Cl2Pd2
Molecular Weight: 365.89
MDL number: MFCD00044874
EINECS: 234-579-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB319.20 | In Stock |
|
| 1G | RMB879.20 | In Stock |
|
| 5G | RMB3919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120°C (dec.) |
| storage temp. | 2-8°C |
| form | Crystals or Crystalline Powder |
| color | Yellow to green-yellow |
| Water Solubility | decomposes |
| Sensitive | Air Sensitive |
| BRN | 4124623 |
| InChI | InChI=1S/2C3H2.2ClH.2Pd/c2*1-3-2;;;;/h2*1-2H;2*1H;;/q2*-1;;;2*+2/p-2 |
| InChIKey | GSVMTGORPBRYQY-UHFFFAOYSA-L |
| SMILES | [Pd+2]123(C=C1[CH-]2)[Cl-][Pd+2]12(C=C1[CH-]2)[Cl-]3 |
| NIST Chemistry Reference | [Pd(Cl)(C3H5)]2(12012-95-2) |
Description and Uses
[Pd(allyl)Cl]2 can be used as a catalyst:
For the silylation of organobromides.
To synthesize α-aryl carbonyl compounds by coupling reaction between aldehydes and aryl halides.
To prepare various arylthiophene derivatives by cross-coupling reaction with aryl halides via C-H functionalization.
Application Guide for Palladium Catalyzed Cross-Coupling Reactions
ChemDose: Convenient Dosing of Catalysts and Reagents
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| RTECS | RT3510000 |
| F | 1-10 |
| TSCA | No |
| HS Code | 28439090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 |




