A0608012
3-Amino-6-bromopyridine , 97% , 13534-97-9
CAS NO.：13534-97-9
Empirical Formula: C5H5BrN2
Molecular Weight: 173.01
MDL number: MFCD01646116
EINECS: 628-541-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB276.80 | In Stock |
|
| 100G | RMB808.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75 °C |
| Boiling point: | 180 °C |
| Density | 1.6065 (rough estimate) |
| refractive index | 1.5182 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 1.87±0.10(Predicted) |
| form | Powder |
| color | Beige to brown-black |
| BRN | 109102 |
| InChI | InChI=1S/C5H5BrN2/c6-5-2-1-4(7)3-8-5/h1-3H,7H2 |
| InChIKey | XTHKRYHULUJQHN-UHFFFAOYSA-N |
| SMILES | C1=NC(Br)=CC=C1N |
| CAS DataBase Reference | 13534-97-9(CAS DataBase Reference) |
Description and Uses
3-Amino-6-bromopyridine may undergo polymerization via Buchwald–Hartwig amination in the presence of sodium tert-butoxide and XPhos(2-dicyclohexylphosphino-2′,4′,6′-triisopropylbiphenyl) ligand yielding para-linked and meta-linked polyaminopyridines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29333990 |
