A0609656
Diisobutylphthalate , 97% , 84-69-5
Synonym(s):
DIBP
CAS NO.:84-69-5
Empirical Formula: C16H22O4
Molecular Weight: 278.34
MDL number: MFCD00026480
EINECS: 201-553-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -64 °C |
| Boiling point: | 327 °C(lit.) |
| Density | 1.039 g/mL at 25 °C(lit.) |
| Pour Point | -45 |
| vapor pressure | 11.2-1470Pa at 100℃ |
| refractive index | n |
| Flash point: | >230 °F |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colorless to Light yellow |
| Odor | Practically odorless when pure |
| Water Solubility | Insoluble |
| FreezingPoint | -50℃ |
| BRN | 2054802 |
| InChI | 1S/C16H22O4/c1-11(2)9-19-15(17)13-7-5-6-8-14(13)16(18)20-10-12(3)4/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | MGWAVDBGNNKXQV-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)c1ccccc1C(=O)OCC(C)C |
| LogP | 4.11-4.45 at 20-30℃ |
| CAS DataBase Reference | 84-69-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Benzenedicarboxylic acid, bis(2-methylpropyl) ester(84-69-5) |
| EPA Substance Registry System | Diisobutyl phthalate (84-69-5) |
Description and Uses
Diisobutyl Phthalate is a Dialkyl phthalate ester phthalate plasticizer which can be used as a substitute of dibutyl phthalate. Diisobutyl Phthalate as well as other phthalates have genotoxic effects and studies shown an increase in its monoester metabolite in human urine over the years.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360FD-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | N,Xn,T |
| Risk Statements | 50/53-63-62-61 |
| Safety Statements | 60-61-36/37-45-53 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | TI1225000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29173400 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B |
| Hazardous Substances Data | 84-69-5(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






